CAS 88609-07-8
:3H-Azepine-3-carboxamide, 2-butoxy-
Description:
3H-Azepine-3-carboxamide, 2-butoxy- is a chemical compound characterized by its azepine ring structure, which is a seven-membered heterocyclic compound containing nitrogen. The presence of a carboxamide functional group indicates that it has an amide bond, contributing to its potential as a polar molecule. The "2-butoxy" substituent suggests that there is a butoxy group attached to the azepine ring, which can influence the compound's solubility and reactivity. This compound may exhibit properties typical of both amides and heterocycles, such as potential biological activity or utility in synthetic applications. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry and material science. The CAS number 88609-07-8 serves as a unique identifier for this substance, facilitating its recognition in chemical databases and literature. Overall, the characteristics of 3H-Azepine-3-carboxamide, 2-butoxy- highlight its potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-2-3-8-15-11-9(10(12)14)6-4-5-7-13-11/h4-7,9H,2-3,8H2,1H3,(H2,12,14)
InChI key:IVPXRZBCWXOPDW-UHFFFAOYSA-N
SMILES:CCCCOC1=NC=CC=CC1C(=O)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
