CymitQuimica logo

CAS 88609-20-5

:

Quinoline, 6,8-dinitro-

Description:
Quinoline, 6,8-dinitro- is a chemical compound characterized by its quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of two nitro groups at the 6 and 8 positions of the quinoline structure significantly influences its chemical properties and reactivity. This compound is typically a yellow to orange crystalline solid and is known for its potential applications in various fields, including organic synthesis and as a precursor for other chemical compounds. The nitro groups contribute to its electron-withdrawing characteristics, which can affect its reactivity in electrophilic substitution reactions. Additionally, quinoline derivatives often exhibit biological activity, making them of interest in medicinal chemistry. However, due to the presence of nitro groups, this compound may also pose environmental and health risks, necessitating careful handling and disposal. As with many nitro compounds, it may be sensitive to heat and shock, highlighting the importance of proper storage and safety measures in its use.
Formula:C9H5N3O4
InChI:InChI=1S/C9H5N3O4/c13-11(14)7-4-6-2-1-3-10-9(6)8(5-7)12(15)16/h1-5H
InChI key:BGFSMXPMBZGPQL-UHFFFAOYSA-N
SMILES:C1=CC2=CC(=CC(=C2N=C1)[N+](=O)[O-])[N+](=O)[O-]
Found 1 products.