CAS 886127-71-5
:2H-1-Benzopyran-3-carboxamide, 6-bromo-2-imino-8-methoxy-
Description:
2H-1-Benzopyran-3-carboxamide, 6-bromo-2-imino-8-methoxy- is a chemical compound characterized by its complex structure, which includes a benzopyran core, a carboxamide functional group, and various substituents such as a bromo group and a methoxy group. This compound is likely to exhibit properties typical of benzopyran derivatives, including potential biological activity due to the presence of the imino and carboxamide functionalities. The bromine atom may influence its reactivity and solubility, while the methoxy group can enhance lipophilicity and affect interactions with biological targets. Such compounds are often studied for their pharmacological properties, including anti-inflammatory, antioxidant, or anticancer activities. The presence of multiple functional groups suggests that it may participate in various chemical reactions, making it a candidate for further research in medicinal chemistry and drug development. As with many organic compounds, its stability, solubility, and reactivity will depend on the specific conditions under which it is studied.
Formula:C11H9BrN2O3
InChI:InChI=1S/C11H9BrN2O3/c1-16-8-4-6(12)2-5-3-7(10(13)15)11(14)17-9(5)8/h2-4,14H,1H3,(H2,13,15)
InChI key:UJHJMOWZZQPOIO-UHFFFAOYSA-N
SMILES:COC1=C2C(=CC(=C1)Br)C=C(C(=N)O2)C(=O)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2H-1-Benzopyran-3-carboxamide, 6-bromo-2-imino-8-methoxy-
CAS:Formula:C11H9BrN2O3Molecular weight:297.1048
