CymitQuimica logo

CAS 88620-28-4

:

3-Thiomorpholinecarboxylic acid, 5-oxo-, 2-ethylhexyl ester

Description:
3-Thiomorpholinecarboxylic acid, 5-oxo-, 2-ethylhexyl ester, identified by its CAS number 88620-28-4, is an organic compound characterized by its ester functional group, which is derived from a thiomorpholine carboxylic acid. This compound features a thiomorpholine ring, contributing to its unique chemical properties, including potential nucleophilicity and reactivity due to the presence of sulfur. The 2-ethylhexyl ester moiety enhances its lipophilicity, making it more soluble in organic solvents and potentially useful in various applications, such as in the formulation of surfactants or as an intermediate in organic synthesis. The presence of the oxo group indicates that it may participate in further chemical reactions, such as condensation or reduction. Overall, this compound's structure suggests it may exhibit interesting biological activities, although specific biological data would require further investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H23NO3S
InChI:InChI=1S/C13H23NO3S/c1-3-5-6-10(4-2)7-17-13(16)11-8-18-9-12(15)14-11/h10-11H,3-9H2,1-2H3,(H,14,15)
InChI key:SMPXIRGPTKXMQE-UHFFFAOYSA-N
SMILES:CCCCC(CC)COC(=O)C1CSCC(=O)N1
Found 1 products.