CymitQuimica logo

CAS 88620-29-5

:

3-Thiomorpholinone, 1-oxide

Description:
3-Thiomorpholinone, 1-oxide, with the CAS number 88620-29-5, is a heterocyclic organic compound characterized by the presence of a morpholine ring that is substituted with a sulfur atom and an oxide functional group. This compound typically exhibits properties associated with both thiol and amine functionalities, which can influence its reactivity and interactions in various chemical environments. It is often used in organic synthesis and may serve as a building block in the development of pharmaceuticals or agrochemicals. The presence of the thiomorpholine structure can impart unique characteristics, such as potential nucleophilicity and the ability to participate in various chemical reactions, including oxidation and substitution reactions. Additionally, the compound may exhibit specific solubility characteristics depending on the solvent used, and its stability can be influenced by environmental factors such as temperature and pH. Overall, 3-Thiomorpholinone, 1-oxide is a versatile compound with applications in synthetic chemistry and material science.
Formula:C4H7NO2S
InChI:InChI=1S/C4H7NO2S/c6-4-3-8(7)2-1-5-4/h1-3H2,(H,5,6)
InChI key:PTNKLPDOKOAQFQ-UHFFFAOYSA-N
SMILES:C1CS(=O)CC(=O)N1
Found 2 products.