CAS 88620-54-6
:3-Penten-2-one, 4-(octadecylamino)-
Description:
3-Penten-2-one, 4-(octadecylamino)- is an organic compound characterized by its long-chain alkyl amine structure, which contributes to its amphiphilic properties. The presence of the octadecyl group provides hydrophobic characteristics, while the 3-penten-2-one moiety introduces a reactive carbonyl group and an unsaturated bond, allowing for potential reactivity in various chemical processes. This compound is typically used in applications such as surfactants, emulsifiers, or as a building block in the synthesis of more complex molecules. Its structure suggests it may exhibit unique properties such as increased solubility in organic solvents and potential interactions with biological membranes. Additionally, the presence of the double bond may allow for further chemical modifications, making it versatile in synthetic organic chemistry. Safety and handling considerations should be taken into account, as with many organic compounds, due to potential reactivity and toxicity. Overall, 3-Penten-2-one, 4-(octadecylamino)- is a notable compound in the field of organic chemistry and materials science.
Formula:C23H45NO
InChI:InChI=1S/C23H45NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(2)21-23(3)25/h21,24H,4-20H2,1-3H3
InChI key:GEBQPJIBVVOGDR-UHFFFAOYSA-N
SMILES:CCCCCCCCCCCCCCCCCCNC(=CC(=O)C)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
