CymitQuimica logo

CAS 886208-65-7

:

Pyridazine, 4-methyl-6-phenyl-3-[4-(2-pyrimidinyl)-1-piperazinyl]-

Description:
Pyridazine, 4-methyl-6-phenyl-3-[4-(2-pyrimidinyl)-1-piperazinyl]- is a synthetic organic compound characterized by its complex structure, which includes a pyridazine ring, a methyl group, a phenyl group, and a piperazine moiety substituted with a pyrimidine. This compound is typically classified as a heterocyclic aromatic compound due to the presence of nitrogen atoms in its ring structures. It exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of multiple functional groups suggests that it may engage in various chemical interactions, which could influence its pharmacological properties. Additionally, the compound's structure may allow for specific binding interactions with biological targets, contributing to its potential therapeutic applications. As with many synthetic compounds, safety and handling precautions are essential, and its effects on biological systems would require thorough investigation through experimental studies.
Formula:C19H20N6
InChI:InChI=1S/C19H20N6/c1-15-14-17(16-6-3-2-4-7-16)22-23-18(15)24-10-12-25(13-11-24)19-20-8-5-9-21-19/h2-9,14H,10-13H2,1H3
InChI key:ASVQCPUSQNFHHU-UHFFFAOYSA-N
SMILES:CC1=CC(=NN=C1N2CCN(CC2)C3=NC=CC=N3)C4=CC=CC=C4
Found 3 products.