CymitQuimica logo

CAS 88621-58-3

:

1,2-Benzisothiazole, 3-(pentafluorophenoxy)-, 1,1-dioxide

Description:
1,2-Benzisothiazole, 3-(pentafluorophenoxy)-, 1,1-dioxide, identified by CAS number 88621-58-3, is a heterocyclic compound featuring a benzisothiazole core substituted with a pentafluorophenoxy group. This compound is characterized by its unique structure, which combines a sulfur and nitrogen-containing ring with a highly fluorinated aromatic moiety. The presence of the pentafluorophenoxy group imparts significant hydrophobicity and enhances the compound's stability and reactivity. Typically, compounds of this nature exhibit interesting biological activities and can serve as intermediates in the synthesis of various pharmaceuticals or agrochemicals. The 1,1-dioxide functional group contributes to its chemical properties, potentially influencing its electron-withdrawing capabilities and overall reactivity. Additionally, the fluorinated substituent may enhance lipophilicity, affecting the compound's solubility and permeability in biological systems. Overall, this compound's unique structural features make it a subject of interest in both synthetic chemistry and material science.
Formula:C13H4F5NO3S
InChI:InChI=1S/C13H4F5NO3S/c14-7-8(15)10(17)12(11(18)9(7)16)22-13-5-3-1-2-4-6(5)23(20,21)19-13/h1-4H
InChI key:YDBTZOOFIPGGBL-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C(=NS2(=O)=O)OC3=C(C(=C(C(=C3F)F)F)F)F
Found 1 products.