CAS 886226-15-9

Formula: C19H22O5

InChI: InChI=1S/C19H22O5/c20-15(8-5-14-7-10-17(22)19(24)12-14)4-2-1-3-13-6-9-16(21)18(23)11-13/h6-7,9-12,21-24H,1-5,8H2

InChI key: UHRUXUCWHIGENP-UHFFFAOYSA-N

SMILES: C1=CC(=C(C=C1CCCCC(=O)CCC2=CC(=C(C=C2)O)O)O)O

Muricarpone B

CAS: 886226-15-9

Muricarpone B is a natural product for research related to life sciences. The catalog number is TN5705 and the CAS number is 886226-15-9.

Formula: C₁₉H₂₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 330.38

Ref: TM-TN5705

Muricarpone B

CAS: 886226-15-9

Muricarpone B is a natural compound that has been shown to inhibit thrombin and TNF-α. It belongs to the class of diphenyl ethers, which are a group of molecules with potent anti-inflammatory activity. Muricarpone B has been shown to have pharmacophoric properties and inhibitory activities against thrombin, TNF-α, and neutrophil elastase in vitro. Muricarpone B also inhibits neutrophil migration in vivo. Muricarpone B is found in plants from the family Rutaceae, including citrus fruits like oranges and lemons.

Formula: C₁₉H₂₂O₅

Purity: Min. 95%

Molecular weight: 330.37 g/mol

Ref: 3D-LKB22615