CAS 88623-38-5
:Imidazo[1,2-a]pyridine-3-acetic acid, 2-(5-bromo-2-furanyl)-6-chloro-
Description:
Imidazo[1,2-a]pyridine-3-acetic acid, 2-(5-bromo-2-furanyl)-6-chloro- is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core fused with a furan ring substituted with bromine. The presence of a chloro group and an acetic acid moiety contributes to its potential reactivity and solubility properties. This compound is typically classified as a heterocyclic organic compound, which may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, possibly influencing various biochemical pathways. The specific arrangement of atoms and functional groups can affect its pharmacokinetics and pharmacodynamics, which are critical for evaluating its therapeutic potential. As with many heterocycles, the compound may also display unique physical properties, such as melting point, boiling point, and solubility in various solvents, which are essential for its application in research and industry.
Formula:C13H8BrClN2O3
InChI:InChI=1S/C13H8BrClN2O3/c14-10-3-2-9(20-10)13-8(5-12(18)19)17-6-7(15)1-4-11(17)16-13/h1-4,6H,5H2,(H,18,19)
InChI key:ZBFMNVGUCZNQNW-UHFFFAOYSA-N
SMILES:C1=CC2=NC(=C(N2C=C1Cl)CC(=O)O)C3=CC=C(O3)Br
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Imidazo[1,2-a]pyridine-3-acetic acid, 2-(5-bromo-2-furanyl)-6-chloro-
CAS:Formula:C13H8BrClN2O3Molecular weight:355.5712
