CymitQuimica logo

CAS 88624-56-0

:

Oxetane, 4-(1,1-dimethylethyl)-2,2-dimethoxy-3-methyl-, cis-

Description:
Oxetane, 4-(1,1-dimethylethyl)-2,2-dimethoxy-3-methyl-, cis- is a cyclic ether characterized by a four-membered ring structure containing an oxygen atom. This compound features a tert-butyl group (1,1-dimethylethyl) and two methoxy groups (–OCH3) attached to the oxetane ring, along with a methyl group. The presence of these substituents contributes to its unique chemical properties, including potential steric hindrance and reactivity. The cis configuration indicates that the substituents are oriented on the same side of the ring, which can influence the compound's physical properties, such as boiling point and solubility. Oxetanes are generally known for their stability and can participate in various chemical reactions, including ring-opening reactions under certain conditions. This compound may have applications in organic synthesis and materials science, particularly in the development of polymers or as intermediates in chemical reactions. However, specific safety and handling information should be consulted due to the potential hazards associated with chemical substances.
Formula:C10H20O3
InChI:InChI=1S/C10H20O3/c1-7-8(9(2,3)4)13-10(7,11-5)12-6/h7-8H,1-6H3/t7-,8-/m0/s1
InChI key:NGCOHRHIQWEYIO-YUMQZZPRSA-N
SMILES:C[C@H]1[C@H](OC1(OC)OC)C(C)(C)C
Found 1 products.