CAS 88624-59-3
:1-Oxaspiro[3.5]nonane, 2,2,3,3-tetramethoxy-
Description:
1-Oxaspiro[3.5]nonane, 2,2,3,3-tetramethoxy- is a chemical compound characterized by its unique spirocyclic structure, which consists of a nonane framework fused with an ether functionality. The presence of four methoxy groups (–OCH3) significantly influences its chemical properties, including solubility and reactivity. This compound is likely to exhibit interesting stereochemical properties due to the spiro arrangement, which can lead to distinct conformational isomers. The methoxy groups can also participate in various chemical reactions, such as methylation or demethylation, and may affect the compound's polarity and interaction with other substances. Additionally, the compound's structure suggests potential applications in organic synthesis, medicinal chemistry, or as a building block in the development of more complex molecules. However, specific biological activity or toxicity data may not be readily available, necessitating further research to fully understand its properties and potential uses. Overall, 1-Oxaspiro[3.5]nonane, 2,2,3,3-tetramethoxy- represents a fascinating example of spirocyclic chemistry.
Formula:C12H22O5
InChI:InChI=1S/C12H22O5/c1-13-11(14-2)10(8-6-5-7-9-10)17-12(11,15-3)16-4/h5-9H2,1-4H3
InChI key:DSSRSOSKNHAHRZ-UHFFFAOYSA-N
SMILES:COC1(C2(CCCCC2)OC1(OC)OC)OC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
