CymitQuimica logo

CAS 88625-15-4

:

Pyridine, 2-chloro-5-[4-(trifluoromethyl)-1H-imidazol-2-yl]-

Description:
Pyridine, 2-chloro-5-[4-(trifluoromethyl)-1H-imidazol-2-yl]- is a heterocyclic organic compound characterized by its pyridine and imidazole functional groups. The presence of a chlorine atom at the 2-position of the pyridine ring and a trifluoromethyl group at the 4-position of the imidazole ring contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It exhibits moderate polarity due to the electronegative chlorine and trifluoromethyl groups, which can influence its solubility in various solvents. The trifluoromethyl group enhances its lipophilicity and can affect its biological activity, making it of interest in pharmaceutical research. Additionally, the compound may exhibit various reactivity patterns typical of halogenated heterocycles, including nucleophilic substitution and electrophilic aromatic substitution. Safety precautions should be taken when handling this compound, as halogenated organic compounds can pose health risks.
Formula:C9H5ClF3N3
InChI:InChI=1S/C9H5ClF3N3/c10-7-2-1-5(3-14-7)8-15-4-6(16-8)9(11,12)13/h1-4H,(H,15,16)
InChI key:IRZKCMPBAYOSPZ-UHFFFAOYSA-N
SMILES:C1=CC(=NC=C1C2=NC=C(N2)C(F)(F)F)Cl
Found 1 products.