CAS 88626-78-2
:Benzene, [(1,5-dimethyl-4-hexenyl)oxy]-
Description:
Benzene, [(1,5-dimethyl-4-hexenyl)oxy]- is an organic compound characterized by its aromatic benzene ring structure, which is substituted with an ether functional group. The presence of the [(1,5-dimethyl-4-hexenyl)oxy] moiety indicates that it has a long carbon chain with multiple methyl groups and a double bond, contributing to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit hydrophobic properties due to the benzene ring, making it less soluble in water but soluble in organic solvents. Its structure suggests that it may participate in various chemical reactions, including electrophilic aromatic substitution, due to the electron-donating effects of the alkyl substituents. Additionally, the compound may have applications in the fragrance industry or as an intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and exposure risks, as many benzene derivatives can be toxic or carcinogenic.
Formula:C14H20O
InChI:InChI=1S/C14H20O/c1-12(2)8-7-9-13(3)15-14-10-5-4-6-11-14/h4-6,8,10-11,13H,7,9H2,1-3H3
InChI key:TUYHMSMGLLMYDE-UHFFFAOYSA-N
SMILES:CC(CCC=C(C)C)OC1=CC=CC=C1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
