CymitQuimica logo

CAS 88627-14-9

:

2-(4-Bromophenyl)-4-chloropyrimidine

Description:
2-(4-Bromophenyl)-4-chloropyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is substituted at the 2-position with a 4-bromophenyl group and at the 4-position with a chlorine atom. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of bromine and chlorine atoms contributes to its reactivity and may influence its solubility and stability in various solvents. Additionally, the compound's molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental impact.
Formula:C10H6BrClN2
InChI:InChI=1S/C10H6BrClN2/c11-8-3-1-7(2-4-8)10-13-6-5-9(12)14-10/h1-6H
InChI key:InChIKey=KBRDFIXSEIZKQG-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC=C1)C2=CC=C(Br)C=C2
Synonyms:
  • 2-(4-Bromophenyl)-4-chloropyrimidine
  • Pyrimidine, 2-(4-bromophenyl)-4-chloro-
Found 2 products.