CAS 88628-47-1
:1(2H)-Naphthalenone, 6-[(4-chlorophenyl)methoxy]-3,4-dihydro-
Description:
1(2H)-Naphthalenone, 6-[(4-chlorophenyl)methoxy]-3,4-dihydro- is an organic compound characterized by its naphthalenone core, which features a ketone functional group. This compound contains a methoxy group attached to a 4-chlorophenyl moiety, contributing to its potential biological activity and chemical reactivity. The presence of the chlorophenyl group may enhance lipophilicity, influencing its solubility and interaction with biological membranes. The dihydro configuration indicates that the compound has undergone partial hydrogenation, which can affect its stability and reactivity. This substance may exhibit various properties such as fluorescence, depending on its molecular structure, and could be of interest in medicinal chemistry for its potential pharmacological applications. Its CAS number, 88628-47-1, allows for easy identification and retrieval of information regarding its synthesis, safety data, and regulatory status. Overall, this compound represents a unique structure that may be explored for various chemical and biological applications.
Formula:C17H15ClO2
InChI:InChI=1S/C17H15ClO2/c18-14-6-4-12(5-7-14)11-20-15-8-9-16-13(10-15)2-1-3-17(16)19/h4-10H,1-3,11H2
InChI key:HEIYQEPVCOFWEN-UHFFFAOYSA-N
SMILES:C1CC2=C(C=CC(=C2)OCC3=CC=C(C=C3)Cl)C(=O)C1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1(2H)-Naphthalenone, 6-[(4-chlorophenyl)methoxy]-3,4-dihydro-
CAS:Formula:C17H15ClO2Molecular weight:286.7528
