CymitQuimica logo

CAS 88628-92-6

:

2,4(1H,3H)-Pyrimidinedione, 6-(2-butenylamino)-1,3-dimethyl-

Description:
2,4(1H,3H)-Pyrimidinedione, 6-(2-butenylamino)-1,3-dimethyl- is a chemical compound characterized by its pyrimidine core structure, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. This compound features a dimethyl substitution at positions 1 and 3, contributing to its unique properties. The presence of a butenylamino group at position 6 introduces additional reactivity and potential for biological activity, making it of interest in medicinal chemistry. The compound is likely to exhibit polar characteristics due to the presence of nitrogen and carbonyl functional groups, which can influence its solubility and interaction with biological systems. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be considered when working with this substance, as with any chemical compound.
Formula:C10H15N3O2
InChI:InChI=1S/C10H15N3O2/c1-4-5-6-11-8-7-9(14)13(3)10(15)12(8)2/h4-5,7,11H,6H2,1-3H3
InChI key:LQDDVPILSKKMHX-UHFFFAOYSA-N
SMILES:CC=CCNC1=CC(=O)N(C(=O)N1C)C
Found 1 products.