CymitQuimica logo

CAS 88629-08-7

:

3H-1,4-Benzodiazepin-3-one, 1,2-dihydro-2,2-dimethyl-5-phenyl-

Description:
3H-1,4-Benzodiazepin-3-one, 1,2-dihydro-2,2-dimethyl-5-phenyl- is a chemical compound belonging to the benzodiazepine class, which is characterized by a fused benzene and diazepine ring structure. This specific compound features a 1,2-dihydro configuration, indicating the presence of a saturated bond in the diazepine ring, along with a phenyl group and two methyl groups at the 2-position, contributing to its unique structural properties. The presence of the carbonyl group at the 3-position is indicative of its classification as a benzodiazepinone. Compounds in this class often exhibit biological activity, including anxiolytic, sedative, and anticonvulsant effects, although the specific pharmacological properties of this compound may vary. Its molecular structure suggests potential interactions with the central nervous system, but detailed studies would be necessary to elucidate its specific effects and applications. As with many benzodiazepines, safety and efficacy profiles would need to be thoroughly evaluated in clinical settings.
Formula:C17H16N2O
InChI:InChI=1S/C17H16N2O/c1-17(2)16(20)18-15(12-8-4-3-5-9-12)13-10-6-7-11-14(13)19-17/h3-11,19H,1-2H3
InChI key:XFGLBBQXQQOWGO-UHFFFAOYSA-N
SMILES:CC1(C(=O)N=C(C2=CC=CC=C2N1)C3=CC=CC=C3)C
Found 1 products.