CymitQuimica logo

CAS 88632-72-8

:

(2R)-2-chloro-1-(2,5-dimethylphenyl)propan-1-one

Description:
(2R)-2-chloro-1-(2,5-dimethylphenyl)propan-1-one, with the CAS number 88632-72-8, is an organic compound characterized by its ketone functional group and a chiral center at the second carbon. This compound features a chlorine atom attached to the second carbon, contributing to its reactivity and potential applications in organic synthesis. The presence of the 2,5-dimethylphenyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. As a chiral molecule, it can exist in two enantiomeric forms, which may exhibit different biological activities or properties. The compound is likely to be a solid at room temperature, with a specific melting point and boiling point that depend on its molecular structure. Its reactivity can be attributed to the electrophilic nature of the carbonyl group, making it suitable for various chemical reactions, including nucleophilic additions. Overall, this compound is of interest in fields such as medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C11H13ClO
InChI:InChI=1/C11H13ClO/c1-7-4-5-8(2)10(6-7)11(13)9(3)12/h4-6,9H,1-3H3/t9-/m1/s1
Found 1 products.