CAS 88633-09-4
:1H-Indene-4-carboxaldehyde, 2,3-dihydro-1,5,6,7-tetramethyl-
Description:
1H-Indene-4-carboxaldehyde, 2,3-dihydro-1,5,6,7-tetramethyl- is an organic compound characterized by its unique structure, which includes an indene ring fused with a carboxaldehyde functional group. This compound features a dihydro structure, indicating the presence of additional hydrogen atoms that contribute to its saturation. The presence of four methyl groups at specific positions on the indene ring enhances its hydrophobic character and may influence its reactivity and solubility in various solvents. Typically, compounds like this may exhibit interesting chemical properties, such as potential reactivity in electrophilic aromatic substitution reactions due to the electron-donating effects of the methyl groups. Additionally, the aldehyde functional group can participate in various chemical reactions, including condensation and oxidation. This compound may find applications in organic synthesis, fragrance formulation, or as an intermediate in the production of more complex molecules. However, specific safety and handling guidelines should be followed, as with all chemical substances, to ensure safe laboratory practices.
Formula:C14H18O
InChI:InChI=1S/C14H18O/c1-8-5-6-12-13(7-15)10(3)9(2)11(4)14(8)12/h7-8H,5-6H2,1-4H3
InChI key:BMIKIAXFXKJUQJ-UHFFFAOYSA-N
SMILES:CC1CCC2=C(C(=C(C(=C12)C)C)C)C=O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1H-Indene-4-carboxaldehyde, 2,3-dihydro-1,5,6,7-tetramethyl-
CAS:Formula:C14H18OMolecular weight:202.2921
