CymitQuimica logo

CAS 88634-81-5

:

Benzenamine, 3,4-dichloro-N-[(5-methyl-1H-imidazol-4-yl)methylene]-

Description:
Benzenamine, 3,4-dichloro-N-[(5-methyl-1H-imidazol-4-yl)methylene]- is an organic compound characterized by its complex structure, which includes a benzene ring substituted with two chlorine atoms at the 3 and 4 positions, and a side chain featuring a 5-methyl-1H-imidazole moiety. This compound is typically classified as an aromatic amine due to the presence of the amine functional group (-NH-) attached to the benzene ring. The imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The dichloro substitution enhances its reactivity and may influence its solubility and stability in various solvents. As with many chlorinated compounds, it may exhibit specific environmental and health considerations, necessitating careful handling and disposal. Overall, this compound's unique structure suggests potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its properties and biological interactions.
Formula:C11H9Cl2N3
InChI:InChI=1S/C11H9Cl2N3/c1-7-11(16-6-15-7)5-14-8-2-3-9(12)10(13)4-8/h2-6H,1H3,(H,15,16)
InChI key:DZRTXCKIQRTGOM-UHFFFAOYSA-N
SMILES:CC1=C(N=CN1)C=NC2=CC(=C(C=C2)Cl)Cl
Found 1 products.