CymitQuimica logo

CAS 886360-67-4

:

6-(2,6-Dimethyl-4-morpholinyl)-3-pyridinecarboxaldehyde

Description:
6-(2,6-Dimethyl-4-morpholinyl)-3-pyridinecarboxaldehyde is a chemical compound characterized by its pyridine and aldehyde functional groups, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of a morpholine ring enhances its solubility and may influence its biological activity. This compound typically exhibits a moderate to high polarity due to the functional groups, which can affect its interaction with biological systems and solvents. Its structure suggests potential for hydrogen bonding, which can play a role in its reactivity and interactions with other molecules. The dimethyl substitution on the morpholine ring may also impact its steric properties and electronic distribution, influencing its overall chemical behavior. As a compound of interest in research, it may be explored for various applications, including as a building block in the synthesis of more complex molecules or as a potential pharmacophore in drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c1-9-6-14(7-10(2)16-9)12-4-3-11(8-15)5-13-12/h3-5,8-10H,6-7H2,1-2H3
InChI key:InChIKey=QJKIFMOLBXODKC-UHFFFAOYSA-N
SMILES:CC1CN(CC(C)O1)C2=CC=C(C=O)C=N2
Synonyms:
  • 6-(2,6-Dimethyl-4-morpholinyl)-3-pyridinecarboxaldehyde
  • 3-Pyridinecarboxaldehyde, 6-(2,6-dimethyl-4-morpholinyl)-
Found 3 products.