CymitQuimica logo

CAS 886360-68-5

:

Ethyl 1-(5-formyl-2-pyridinyl)-4-piperidinecarboxylate

Description:
Ethyl 1-(5-formyl-2-pyridinyl)-4-piperidinecarboxylate, identified by its CAS number 886360-68-5, is a chemical compound that features a complex structure incorporating both a pyridine and a piperidine moiety. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid or solid, depending on its purity and form. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while exhibiting limited solubility in water due to its hydrophobic piperidine ring. The presence of the formyl group suggests potential reactivity, particularly in condensation reactions, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, as many derivatives of piperidine and pyridine are known for their pharmacological properties. Its stability under standard laboratory conditions is expected, although specific handling precautions should be taken due to the potential reactivity of the aldehyde functional group. Overall, this compound represents a valuable structure in medicinal chemistry and synthetic organic chemistry.
Formula:C14H18N2O3
InChI:InChI=1S/C14H18N2O3/c1-2-19-14(18)12-5-7-16(8-6-12)13-4-3-11(10-17)9-15-13/h3-4,9-10,12H,2,5-8H2,1H3
InChI key:InChIKey=RKWDWOQKMXXYEK-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1CCN(CC1)C2=CC=C(C=O)C=N2
Synonyms:
  • 4-Piperidinecarboxylic acid, 1-(5-formyl-2-pyridinyl)-, ethyl ester
  • Ethyl 1-(5-formyl-2-pyridinyl)-4-piperidinecarboxylate
Found 1 products.