CymitQuimica logo

CAS 886360-73-2

:

5-nitro-2-piperazin-1-ylbenzoic acid

Description:
5-Nitro-2-piperazin-1-ylbenzoic acid is a chemical compound characterized by its structure, which includes a benzoic acid moiety substituted with a nitro group and a piperazine ring. The presence of the nitro group typically imparts certain reactivity and polarity to the molecule, while the piperazine ring contributes to its potential biological activity and solubility properties. This compound may exhibit properties such as being a weak acid due to the carboxylic acid functional group, and it may participate in hydrogen bonding due to the presence of both the carboxylic acid and the piperazine nitrogen atoms. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperazine derivatives are often explored for their therapeutic effects. Additionally, the compound's CAS number, 886360-73-2, allows for its identification in chemical databases, facilitating research and development efforts. Overall, 5-nitro-2-piperazin-1-ylbenzoic acid is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C11H13N3O4
InChI:InChI=1/C11H13N3O4/c15-11(16)9-7-8(14(17)18)1-2-10(9)13-5-3-12-4-6-13/h1-2,7,12H,3-6H2,(H,15,16)
InChI key:PYZUYRBYEKFTPS-UHFFFAOYSA-N
SMILES:c1cc(c(cc1N(=O)=O)C(=O)O)N1CCNCC1
Synonyms:
  • 5-Nitro-2-(piperazin-1-yl)benzoic acid
  • Benzoic acid, 5-nitro-2-(1-piperazinyl)-
Found 2 products.