CymitQuimica logo

CAS 886360-96-9

:

2-Butyl-6-nitrobenzoxazole

Description:
2-Butyl-6-nitrobenzoxazole is an organic compound characterized by its benzoxazole structure, which consists of a fused benzene and oxazole ring. The presence of a butyl group at the 2-position and a nitro group at the 6-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic butyl group. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. 2-Butyl-6-nitrobenzoxazole may be used in various applications, including as a fluorescent probe or in the synthesis of other chemical entities. Its potential biological activity and interactions with other molecules make it of interest in medicinal chemistry and materials science. As with many nitro-containing compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C11H12N2O3
InChI:InChI=1S/C11H12N2O3/c1-2-3-4-11-12-9-6-5-8(13(14)15)7-10(9)16-11/h5-7H,2-4H2,1H3
InChI key:InChIKey=ZEVHKNJYRVOCBY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(N=C(CCCC)O2)=CC1
Synonyms:
  • Benzoxazole, 2-butyl-6-nitro-
  • 2-Butyl-6-nitrobenzoxazole
  • 2-Butyl-6-nitro-1,3-benzoxazole
Found 1 products.