CymitQuimica logo

CAS 886361-00-8

:

3-[5-(Trifluoromethyl)-2-pyridinyl]benzenamine

Description:
3-[5-(Trifluoromethyl)-2-pyridinyl]benzenamine, with the CAS number 886361-00-8, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with an amino group and a pyridine moiety that features a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds, such as moderate to high stability under standard conditions, and it may display solubility in organic solvents. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's reactivity and biological activity. Additionally, the pyridine ring contributes to the compound's potential as a ligand in coordination chemistry or as an intermediate in organic synthesis. Its unique structural features may also impart specific electronic properties, making it of interest in medicinal chemistry and material science. Safety and handling considerations should be observed, as with many fluorinated compounds, due to potential toxicity and environmental impact.
Formula:C12H9F3N2
InChI:InChI=1S/C12H9F3N2/c13-12(14,15)9-4-5-11(17-7-9)8-2-1-3-10(16)6-8/h1-7H,16H2
InChI key:InChIKey=HMHNOBLOCBYEFL-UHFFFAOYSA-N
SMILES:NC=1C=C(C=CC1)C2=CC=C(C(F)(F)F)C=N2
Synonyms:
  • 2-(3-Aminophenyl)-5-trifluoromethylpyridine
  • Benzenamine, 3-[5-(trifluoromethyl)-2-pyridinyl]-
  • 3-[5-(Trifluoromethyl)-2-pyridinyl]benzenamine
Found 1 products.