CymitQuimica logo

CAS 886361-06-4

:

1,3,4,5,7,8-Hexahydro-3-methyl-2,6-quinolinedione

Description:
1,3,4,5,7,8-Hexahydro-3-methyl-2,6-quinolinedione, with the CAS number 886361-06-4, is a chemical compound characterized by its bicyclic structure, which includes a quinoline moiety. This compound features a hexahydro framework, indicating that it contains a saturated ring system, and a methyl group at the 3-position of the quinolinedione structure. The presence of the dione functional groups suggests that it has two carbonyl (C=O) groups, contributing to its reactivity and potential biological activity. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for various applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Additionally, the compound may possess interesting properties such as fluorescence or specific binding affinities, which can be explored in further research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-6-4-7-5-8(12)2-3-9(7)11-10(6)13/h6H,2-5H2,1H3,(H,11,13)
InChI key:InChIKey=GFLXDHHKWBVIOH-UHFFFAOYSA-N
SMILES:CC1CC2=C(NC1=O)CCC(=O)C2
Synonyms:
  • 2,6-Quinolinedione, 1,3,4,5,7,8-hexahydro-3-methyl-
  • 1,3,4,5,7,8-Hexahydro-3-methyl-2,6-quinolinedione
Found 1 products.