CymitQuimica logo

CAS 886361-16-6

:

2,3,4,5,6-Pentafluorophenyl 2,3,4,5,6-pentamethylbenzenesulfonate

Description:
2,3,4,5,6-Pentafluorophenyl 2,3,4,5,6-pentamethylbenzenesulfonate is a synthetic organic compound characterized by its complex structure, which includes a pentafluorophenyl group and a sulfonate moiety attached to a highly substituted pentamethylbenzene framework. This compound is notable for its high fluorine content, which imparts unique electronic and chemical properties, such as increased stability and hydrophobicity. The presence of multiple methyl groups enhances steric hindrance, potentially influencing its reactivity and solubility in various solvents. As a sulfonate, it may exhibit good leaving group properties in nucleophilic substitution reactions, making it useful in organic synthesis. Additionally, the fluorinated aromatic system can contribute to enhanced interactions in biological systems or materials science applications. Overall, this compound's distinctive characteristics make it a subject of interest in fields such as medicinal chemistry, materials science, and fluorine chemistry. However, specific handling and safety precautions should be observed due to the potential hazards associated with fluorinated compounds.
Formula:C17H15F5O3S
InChI:InChI=1S/C17H15F5O3S/c1-6-7(2)9(4)17(10(5)8(6)3)26(23,24)25-16-14(21)12(19)11(18)13(20)15(16)22/h1-5H3
InChI key:InChIKey=JGEDRIPJERBADH-UHFFFAOYSA-N
SMILES:S(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)(=O)C2=C(C)C(C)=C(C)C(C)=C2C
Synonyms:
  • Benzenesulfonic acid, 2,3,4,5,6-pentamethyl-, 2,3,4,5,6-pentafluorophenyl ester
  • 2,3,4,5,6-Pentafluorophenyl 2,3,4,5,6-pentamethylbenzenesulfonate
Found 1 products.