CymitQuimica logo

CAS 886361-23-5

:

4-[(3-Fluorophenyl)methoxy]benzoic acid hydrazide

Description:
4-[(3-Fluorophenyl)methoxy]benzoic acid hydrazide, identified by its CAS number 886361-23-5, is a chemical compound characterized by its hydrazide functional group, which is linked to a benzoic acid moiety. This compound features a methoxy group and a fluorophenyl substituent, contributing to its unique chemical properties. The presence of the fluorine atom in the aromatic ring can influence the compound's reactivity and biological activity, often enhancing lipophilicity and altering electronic properties. The hydrazide functional group is known for its potential in forming various derivatives and can participate in diverse chemical reactions, including condensation and hydrazone formation. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 4-[(3-Fluorophenyl)methoxy]benzoic acid hydrazide represents a versatile structure with potential applications in drug development and organic synthesis.
Formula:C14H13FN2O2
InChI:InChI=1S/C14H13FN2O2/c15-12-3-1-2-10(8-12)9-19-13-6-4-11(5-7-13)14(18)17-16/h1-8H,9,16H2,(H,17,18)
InChI key:InChIKey=JBMGTWZQHYDEAX-UHFFFAOYSA-N
SMILES:O(CC1=CC(F)=CC=C1)C2=CC=C(C(NN)=O)C=C2
Synonyms:
  • Benzoic acid, 4-[(3-fluorophenyl)methoxy]-, hydrazide
  • 4-[(3-Fluorophenyl)methoxy]benzoic acid hydrazide
Found 1 products.