CymitQuimica logo

CAS 886361-62-2

:

2-Propyl-5-benzoxazolamine

Description:
2-Propyl-5-benzoxazolamine is an organic compound characterized by its unique structure, which includes a benzoxazole ring and an amine functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the propyl group enhances its hydrophobic characteristics, which may influence its solubility and reactivity. As a benzoxazole derivative, it may also exhibit biological activity, making it of interest for medicinal chemistry. The compound's molecular interactions can be influenced by the amine group, which can participate in hydrogen bonding and affect its overall stability and reactivity. Additionally, 2-Propyl-5-benzoxazolamine may undergo various chemical reactions typical of amines and heterocycles, such as electrophilic substitution or nucleophilic attack, depending on the reaction conditions. Overall, its structural features suggest a versatile compound with potential utility in diverse chemical applications.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c1-2-3-10-12-8-6-7(11)4-5-9(8)13-10/h4-6H,2-3,11H2,1H3
InChI key:InChIKey=WYENCKOREHAFMD-UHFFFAOYSA-N
SMILES:C(CC)C1=NC=2C(O1)=CC=C(N)C2
Synonyms:
  • 2-Propyl-1,3-benzoxazol-5-amine
  • 2-Propyl-5-benzoxazolamine
  • 5-Benzoxazolamine, 2-propyl-
  • 2-Propylbenzo[d]oxazol-5-amine
Found 1 products.