CymitQuimica logo

CAS 886361-83-7

:

(Z)-2-(2-bromobenzoyl)-3-(dimethylamino)prop-2-enenitrile

Description:
(Z)-2-(2-bromobenzoyl)-3-(dimethylamino)prop-2-enenitrile is an organic compound characterized by its unique structural features, including a bromobenzoyl group and a dimethylamino group attached to a prop-2-enenitrile backbone. This compound exhibits a Z configuration, indicating that the highest priority substituents on the double bond are on the same side, which can influence its reactivity and interactions. The presence of the bromine atom introduces significant electronegativity, potentially enhancing the compound's reactivity in nucleophilic substitution reactions. The dimethylamino group contributes basicity and can participate in hydrogen bonding, affecting solubility and interaction with other molecules. Additionally, the nitrile functional group (-C≡N) is known for its polar character and can engage in dipole-dipole interactions. Overall, this compound's characteristics make it of interest in various chemical applications, including pharmaceuticals and organic synthesis, where its reactivity and functional groups can be exploited for further transformations.
Formula:C12H11BrN2O
InChI:InChI=1/C12H11BrN2O/c1-15(2)8-9(7-14)12(16)10-5-3-4-6-11(10)13/h3-6,8H,1-2H3/b9-8-
InChI key:YACLVWZVUUPOTD-CMDGGOBGSA-N
SMILES:CN(C)/C=C(/C#N)\C(=O)c1ccccc1Br
Synonyms:
  • (2Z)-2-(2-Bromobenzoyl)-3-(dimethylamino)acrylonitrile
Found 2 products.