CymitQuimica logo

CAS 886361-91-7

:

3-Pyridinecarboxylic acid, 2-(cyclohexylmethylamino)-

Description:
3-Pyridinecarboxylic acid, 2-(cyclohexylmethylamino)-, identified by its CAS number 886361-91-7, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 3-position of the pyridine ring, contributing to its acidic properties. The presence of a cyclohexylmethylamino group at the 2-position introduces a secondary amine, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. The overall structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of pyridine derivatives to interact with biological targets. Additionally, the compound may exhibit specific physical properties such as melting point, boiling point, and solubility in various solvents, which are essential for its practical applications. However, detailed experimental data would be necessary to fully characterize its behavior in different environments.
Formula:C13H18N2O2
InChI:InChI=1S/C13H18N2O2/c1-15(10-6-3-2-4-7-10)12-11(13(16)17)8-5-9-14-12/h5,8-10H,2-4,6-7H2,1H3,(H,16,17)
InChI key:InChIKey=NBWYSKBYIIBKEY-UHFFFAOYSA-N
SMILES:N(C)(C1=C(C(O)=O)C=CC=N1)C2CCCCC2
Synonyms:
  • 2-[Cyclohexyl(methyl)amino]pyridine-3-carboxylic acid
  • 2-[Cyclohexyl(methyl)amino]nicotinic acid
  • 3-Pyridinecarboxylic acid, 2-(cyclohexylmethylamino)-
Found 1 products.