CymitQuimica logo

CAS 886361-97-3

:

Imidazo[1,2-a]pyridine-6-carboxylic acid, hydrazide

Description:
Imidazo[1,2-a]pyridine-6-carboxylic acid, hydrazide is a chemical compound characterized by its unique imidazo-pyridine structure, which incorporates both a hydrazide functional group and a carboxylic acid moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for hydrazides due to their ability to form hydrogen bonds. The presence of the imidazo ring contributes to its potential biological activity, making it of interest in medicinal chemistry. It may exhibit various pharmacological properties, including antimicrobial or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. The compound's molecular structure allows for potential interactions with biological targets, making it a candidate for drug development. Additionally, its stability under standard laboratory conditions is generally favorable, although it may be sensitive to extreme pH or temperature variations. Overall, Imidazo[1,2-a]pyridine-6-carboxylic acid, hydrazide represents a versatile scaffold for further chemical modifications and applications in pharmaceutical research.
Formula:C8H8N4O
InChI:InChI=1S/C8H8N4O/c9-11-8(13)6-1-2-7-10-3-4-12(7)5-6/h1-5H,9H2,(H,11,13)
InChI key:InChIKey=ZMQNWDRVASCREF-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=CN2C(C=C1)=NC=C2
Synonyms:
  • Imidazo[1,2-a]pyridine-6-carboxylic acid, hydrazide
  • Imidazo[1,2-a]pyridine-6-carbohydrazide
Found 2 products.