CymitQuimica logo

CAS 886362-04-5

:

2-(tert-butoxycarbonyl-methyl-amino)-5-chloro-benzoic acid

Description:
2-(tert-butoxycarbonyl-methyl-amino)-5-chloro-benzoic acid is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a chlorine atom and a tert-butoxycarbonyl (Boc) protected amino group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the amino group. The tert-butoxycarbonyl group serves as a protective group for the amine, making the compound useful in synthetic organic chemistry, particularly in peptide synthesis and drug development. The chlorine substituent can influence the compound's reactivity and solubility, potentially enhancing its biological activity. Additionally, the presence of the bulky tert-butoxycarbonyl group may affect the steric hindrance and overall conformation of the molecule. Overall, this compound is of interest in medicinal chemistry and may have applications in the development of pharmaceuticals or as a building block in organic synthesis.
Formula:C13H16ClNO4
InChI:InChI=1/C13H16ClNO4/c1-13(2,3)19-12(18)15(4)10-6-5-8(14)7-9(10)11(16)17/h5-7H,1-4H3,(H,16,17)
InChI key:XCSUEKNXBQVILR-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N(C)c1ccc(cc1C(=O)O)Cl
Synonyms:
  • 2-[(tert-Butoxycarbonyl)(methyl)amino]-5-chlorobenzoic acid
Found 2 products.