CymitQuimica logo

CAS 886362-14-7

:

4-(5-Oxazolyl)benzoic acid hydrazide

Description:
4-(5-Oxazolyl)benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group attached to a benzoic acid moiety, with an oxazole ring substituent. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of both hydrophilic and hydrophobic regions. The oxazole ring contributes to its potential biological activity, as heterocycles often play significant roles in medicinal chemistry. The hydrazide functional group can participate in various chemical reactions, including hydrazone formation and potential interactions with biological targets. Additionally, this compound may exhibit acidic properties due to the carboxylic acid group, influencing its reactivity and solubility. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of antimicrobial or anti-inflammatory agents. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise values. Overall, 4-(5-Oxazolyl)benzoic acid hydrazide represents a versatile scaffold for further chemical exploration and application.
Formula:C10H9N3O2
InChI:InChI=1S/C10H9N3O2/c11-13-10(14)8-3-1-7(2-4-8)9-5-12-6-15-9/h1-6H,11H2,(H,13,14)
InChI key:InChIKey=ZHYJVYAAIVMXIW-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=CC=C(C=C1)C2=CN=CO2
Synonyms:
  • Benzoic acid, 4-(5-oxazolyl)-, hydrazide
  • 4-(5-Oxazolyl)benzoic acid hydrazide
Found 3 products.