CymitQuimica logo

CAS 886362-43-2

:

1,1-Dimethylethyl 7-(aminomethyl)-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxylate

Description:
1,1-Dimethylethyl 7-(aminomethyl)-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxylate, with the CAS number 886362-43-2, is a chemical compound characterized by its complex structure, which includes a naphthyridine core. This compound features a carboxylate functional group, contributing to its potential as a bioactive molecule. The presence of an aminomethyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The dimethyl group attached to the carbon atom enhances its steric properties, which may influence its solubility and reactivity. Typically, compounds of this nature are studied for their pharmacological properties, including potential roles as enzyme inhibitors or in other therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be assessed through various analytical methods. Overall, this compound represents a class of organic molecules that may have significant implications in drug development and other chemical applications.
Formula:C14H21N3O2
InChI:InChI=1S/C14H21N3O2/c1-14(2,3)19-13(18)17-8-4-5-10-6-7-11(9-15)16-12(10)17/h6-7H,4-5,8-9,15H2,1-3H3
InChI key:InChIKey=MNWCZZLNXDJWKU-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(=CC=C(CN)N2)CCC1
Synonyms:
  • 1,8-Naphthyridine-1(2H)-carboxylic acid, 7-(aminomethyl)-3,4-dihydro-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 7-(aminomethyl)-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxylate
Found 2 products.