CymitQuimica logo

CAS 886362-44-3

:

1,1-Dimethylethyl 7-(3-aminopropyl)-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxylate

Description:
1,1-Dimethylethyl 7-(3-aminopropyl)-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxylate, with the CAS number 886362-44-3, is a chemical compound characterized by its complex structure, which includes a naphthyridine core. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the dimethyl group enhances its steric bulk, which may influence its biological activity and interaction with other molecules. The amino propyl side chain suggests potential for hydrogen bonding and interaction with biological targets, making it of interest in medicinal chemistry. Its dihydro form indicates that it may exist in a reduced state, which can affect its stability and reactivity. Overall, this compound may exhibit unique pharmacological properties, warranting further investigation in drug development and therapeutic applications. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C16H25N3O2
InChI:InChI=1S/C16H25N3O2/c1-16(2,3)21-15(20)19-11-5-6-12-8-9-13(7-4-10-17)18-14(12)19/h8-9H,4-7,10-11,17H2,1-3H3
InChI key:InChIKey=OFEIZXQEHYYUPC-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(=CC=C(CCCN)N2)CCC1
Synonyms:
  • 1,8-Naphthyridine-1(2H)-carboxylic acid, 7-(3-aminopropyl)-3,4-dihydro-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 7-(3-aminopropyl)-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxylate
Found 2 products.