CymitQuimica logo

CAS 886362-59-0

:

tert-butyl 2,6-dioxo-4-[4-(trifluoromethyl)phenyl]-1,3-oxazinane-3-carboxylate

Description:
Tert-butyl 2,6-dioxo-4-[4-(trifluoromethyl)phenyl]-1,3-oxazinane-3-carboxylate is a synthetic organic compound characterized by its complex structure, which includes an oxazinane ring, carbonyl groups, and a tert-butyl ester functional group. The presence of the trifluoromethyl group on the phenyl ring enhances its lipophilicity and may influence its reactivity and biological activity. This compound is typically used in medicinal chemistry and material science due to its potential as a building block in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit interesting properties such as stability under various conditions, and it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The oxazinane moiety can also impart unique characteristics, such as the ability to form hydrogen bonds, which can affect solubility and interaction with biological targets. Overall, this compound's unique features make it a subject of interest in research and development within the chemical and pharmaceutical industries.
Formula:C16H16F3NO5
InChI:InChI=1/C16H16F3NO5/c1-15(2,3)25-14(23)20-11(8-12(21)24-13(20)22)9-4-6-10(7-5-9)16(17,18)19/h4-7,11H,8H2,1-3H3
InChI key:GTJHNHAOCHVEEG-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1C(CC(=O)OC1=O)c1ccc(cc1)C(F)(F)F
Found 2 products.