CymitQuimica logo

CAS 886362-62-5

:

tert-butyl 4-(3-bromophenyl)piperidine-1-carboxylate

Description:
Tert-butyl 4-(3-bromophenyl)piperidine-1-carboxylate is an organic compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a tert-butyl ester group, contributing to its lipophilicity and stability. The presence of a 3-bromophenyl substituent enhances its potential for biological activity, as halogenated aromatic groups often play a role in modulating interactions with biological targets. The carboxylate functional group indicates that this compound can participate in various chemical reactions, such as esterification or hydrolysis. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperidine moiety's prevalence in many bioactive compounds. Additionally, the compound's properties, such as solubility, melting point, and reactivity, would be influenced by the steric and electronic effects of the tert-butyl and bromophenyl groups. Overall, tert-butyl 4-(3-bromophenyl)piperidine-1-carboxylate is a versatile compound with significant implications in chemical research and drug development.
Formula:C16H22BrNO2
InChI:InChI=1/C16H22BrNO2/c1-16(2,3)20-15(19)18-9-7-12(8-10-18)13-5-4-6-14(17)11-13/h4-6,11-12H,7-10H2,1-3H3
InChI key:SDAPURUFUOOCTE-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)c1cccc(c1)Br
Synonyms:
  • 4-(3-Bromo-phenyl)-piperidine-1-carboxylic acid tert-butyl ester
Found 4 products.