CymitQuimica logo

CAS 886362-65-8

:

1-[(Phenylmethoxy)carbonyl]-3-pyrrolidineacetic acid

Description:
1-[(Phenylmethoxy)carbonyl]-3-pyrrolidineacetic acid, identified by its CAS number 886362-65-8, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a phenylmethoxycarbonyl group, which contributes to its structural complexity and potential reactivity. The carboxylic acid functional group in its structure suggests that it can participate in various chemical reactions, such as esterification or amidation. The compound's molecular structure indicates that it may exhibit specific biological activities, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research or pharmaceutical contexts. Overall, this compound's unique structural features and functional groups make it a subject of interest for further study in organic synthesis and potential therapeutic applications.
Formula:C14H17NO4
InChI:InChI=1S/C14H17NO4/c16-13(17)8-12-6-7-15(9-12)14(18)19-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,16,17)
InChI key:InChIKey=IUYVTLSEDKQGQY-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC(CC(O)=O)CC2
Synonyms:
  • 1-N-Cbz-pyrrolidine-3-acetic acid
  • 1-N-Cbz-pyrrolidine-3-aceticacid
  • 1-[(Phenylmethoxy)carbonyl]-3-pyrrolidineacetic acid
  • 2-[1-[(Benzyloxy)carbonyl]pyrrolidin-3-yl]acetic acid
  • 3-Pyrrolidineacetic acid, 1-[(phenylmethoxy)carbonyl]-
  • {1-[(Benzyloxy)carbonyl]pyrrolidin-3-yl}acetic acid
Found 4 products.