CAS 886362-68-1
:4-Fluoro-2-methylindole-3-carboxylic acid ethyl ester
Description:
4-Fluoro-2-methylindole-3-carboxylic acid ethyl ester is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluoro group at the 4-position and a methyl group at the 2-position of the indole ring contributes to its unique chemical properties. The carboxylic acid moiety, esterified with an ethyl group, enhances its solubility and reactivity, making it useful in various synthetic applications. This compound may exhibit biological activity, potentially serving as a scaffold for drug development or as an intermediate in organic synthesis. Its molecular structure allows for various functionalization possibilities, which can be explored in medicinal chemistry. Additionally, the presence of the fluorine atom can influence the compound's electronic properties, stability, and interaction with biological targets. As with many indole derivatives, it may also exhibit fluorescence, making it of interest in materials science and biological imaging.
Formula:C12H12FNO2
InChI:InChI=1/C12H12FNO2/c1-3-16-12(15)10-7(2)14-9-6-4-5-8(13)11(9)10/h4-6,14H,3H2,1-2H3
InChI key:FFLAUZJZZHRPQM-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c(C)[nH]c2cccc(c12)F
Synonyms:- 1H-Indole-3-carboxylic acid, 4-fluoro-2-methyl-, ethyl ester
- Ethyl 4-fluoro-2-methyl-1H-indole-3-carboxylate
- 4-Fluoro-2-methlindole-3-carboxylic acid ethyl ester
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
ethyl 4-fluoro-2-methyl-1H-indole-3-carboxylate
CAS:Formula:C12H12FNO2Color and Shape:SolidMolecular weight:221.2276
