CymitQuimica logo

CAS 886362-69-2

:

Ethyl 6-fluoro-2-methyl-1H-indole-3-carboxylate

Description:
Ethyl 6-fluoro-2-methyl-1H-indole-3-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluoro group at the 6-position and a methyl group at the 2-position contributes to its unique reactivity and properties. This compound features an ethyl ester functional group at the carboxylate position, which enhances its solubility in organic solvents and may influence its biological activity. Ethyl 6-fluoro-2-methyl-1H-indole-3-carboxylate is of interest in medicinal chemistry, particularly for its potential applications in drug development, as indole derivatives often exhibit a range of pharmacological activities. The compound's molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Additionally, its specific fluorination can impact its electronic properties, potentially affecting its interactions with biological targets. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H12FNO2
InChI:InChI=1S/C12H12FNO2/c1-3-16-12(15)11-7(2)14-10-6-8(13)4-5-9(10)11/h4-6,14H,3H2,1-2H3
InChI key:InChIKey=GOKWPANDLYARQA-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2C(NC1C)=CC(F)=CC2
Synonyms:
  • 1H-Indole-3-carboxylic acid, 6-fluoro-2-methyl-, ethyl ester
  • 6-Fluoro-2-methylindole-3-carboxylic acid ethyl ester
  • Ethyl 6-fluoro-2-methyl-1H-indole-3-carboxylate
Found 2 products.