CymitQuimica logo

CAS 886362-70-5

:

Ethyl 5-fluoro-2-methyl-1H-indole-3-carboxylate

Description:
Ethyl 5-fluoro-2-methyl-1H-indole-3-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluoro group at the 5-position and a methyl group at the 2-position of the indole ring contributes to its unique chemical properties. This compound features an ethyl ester functional group at the carboxylate position, which enhances its solubility in organic solvents and may influence its reactivity. Ethyl 5-fluoro-2-methyl-1H-indole-3-carboxylate is of interest in medicinal chemistry and drug development due to its potential biological activity, particularly in the context of targeting specific receptors or enzymes. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. As with many fluorinated compounds, it may exhibit distinct pharmacokinetic properties, including altered metabolic stability and bioavailability. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.
Formula:C12H12FNO2
InChI:InChI=1S/C12H12FNO2/c1-3-16-12(15)11-7(2)14-10-5-4-8(13)6-9(10)11/h4-6,14H,3H2,1-2H3
InChI key:InChIKey=FORZEOSWWHEOEL-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2C(NC1C)=CC=C(F)C2
Synonyms:
  • 1H-Indole-3-carboxylic acid, 5-fluoro-2-methyl-, ethyl ester
  • 5-Fluoro-2-methylindole-3-carboxylic acid ethyl ester
  • 5-Fluoro-2-methylindole-3-carboxylic acid ethylester
  • Ethyl 5-fluoro-2-methyl-1H-indole-3-carboxylate
Found 3 products.