CymitQuimica logo

CAS 886362-73-8

:

4-chloro-6-fluoro-quinoline-3-carbonitrile

Description:
4-Chloro-6-fluoro-quinoline-3-carbonitrile is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chloro group at the 4-position and a fluoro group at the 6-position contributes to its unique chemical properties, influencing its reactivity and potential applications. The carbonitrile functional group at the 3-position introduces a strong electron-withdrawing characteristic, enhancing the compound's polarity and solubility in polar solvents. This compound is typically used in medicinal chemistry and drug development due to its potential biological activity, particularly in the field of antimicrobial and anticancer research. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the halogen substituents, which can modulate its interaction with biological targets. Overall, 4-chloro-6-fluoro-quinoline-3-carbonitrile is a significant compound in the study of pharmaceuticals and agrochemicals.
Formula:C10H4ClFN2
InChI:InChI=1/C10H4ClFN2/c11-10-6(4-13)5-14-9-2-1-7(12)3-8(9)10/h1-3,5H
InChI key:OKGBGMNVXKHICZ-UHFFFAOYSA-N
SMILES:c1cc2c(cc1F)c(c(C#N)cn2)Cl
Synonyms:
  • 3-Quinolinecarbonitrile, 4-chloro-6-fluoro-
  • 4-Chloro-6-Fluoroquinoline-3-Carbonitrile
  • 4-Chloro-6-fluoro-3-quinolinecarbonitrile
  • 4-Chloro-6-fluoro-quinoline-3-ca
Found 3 products.