CymitQuimica logo

CAS 886362-86-3

:

9H-fluoren-9-ylmethyl 3-cyanopiperidine-1-carboxylate

Description:
9H-fluoren-9-ylmethyl 3-cyanopiperidine-1-carboxylate is a chemical compound characterized by its unique structure, which includes a fluorenyl group and a piperidine ring. This compound features a carboxylate functional group and a cyano group, contributing to its reactivity and potential applications in medicinal chemistry. The fluorenyl moiety provides stability and lipophilicity, which can enhance the compound's bioavailability. The presence of the piperidine ring suggests potential interactions with biological targets, making it of interest in drug development. Additionally, the cyano group can participate in various chemical reactions, allowing for further modifications. The compound's molecular weight, solubility, and specific reactivity profiles would depend on its structural features and the surrounding environment. Overall, 9H-fluoren-9-ylmethyl 3-cyanopiperidine-1-carboxylate is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C21H20N2O2
InChI:InChI=1/C21H20N2O2/c22-12-15-6-5-11-23(13-15)21(24)25-14-20-18-9-3-1-7-16(18)17-8-2-4-10-19(17)20/h1-4,7-10,15,20H,5-6,11,13-14H2
InChI key:HWYCMBISZMDDLP-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=O)N1CCCC(C#N)C1
Synonyms:
  • 3-Cyano-1-N-Fmoc-piperidine
  • 9H-Fluoren-9-ylmethyl 3-cyanopiperidine-1-carboxylate
Found 2 products.