CymitQuimica logo

CAS 886362-94-3

:

1-(3,5-Difluorophenyl)-3-(1-methylethyl)-1H-indole-2-methanol

Description:
1-(3,5-Difluorophenyl)-3-(1-methylethyl)-1H-indole-2-methanol, identified by its CAS number 886362-94-3, is a synthetic organic compound characterized by its complex structure, which includes an indole core substituted with a difluorophenyl group and an isopropyl group. This compound typically exhibits properties associated with indole derivatives, such as potential biological activity, including interactions with various receptors or enzymes. The presence of fluorine atoms can enhance lipophilicity and metabolic stability, potentially influencing its pharmacokinetic properties. The hydroxymethyl group at the indole position may contribute to its reactivity and solubility in polar solvents. As with many indole derivatives, it may be of interest in medicinal chemistry for its potential therapeutic applications, including anti-inflammatory or anticancer activities. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise values. Overall, this compound represents a class of molecules that are often explored for their biological significance and utility in drug development.
Formula:C18H17F2NO
InChI:InChI=1/C18H17F2NO/c1-11(2)18-15-5-3-4-6-16(15)21(17(18)10-22)14-8-12(19)7-13(20)9-14/h3-9,11,22H,10H2,1-2H3
InChI key:InChIKey=DPPNYCACUIUFAY-UHFFFAOYSA-N
SMILES:C(O)C=1N(C=2C(C1C(C)C)=CC=CC2)C3=CC(F)=CC(F)=C3
Synonyms:
  • 1-(3',5'-Difluorophenyl)-2-hydroxymethyl-3-isopropylindole
  • 1-(3,5-Difluorophenyl)-3-(1-methylethyl)-1H-indole-2-methanol
  • 1H-Indole-2-methanol, 1-(3,5-difluorophenyl)-3-(1-methylethyl)-
  • [1-(3,5-Difluorophenyl)-3-isopropyl-1H-indol-2-yl]methanol
Found 2 products.