CymitQuimica logo

CAS 886362-96-5

:

Carbamic acid, methyl[2-(1-pyrrolidinyl)ethyl]-, phenylmethyl ester

Description:
Carbamic acid, methyl[2-(1-pyrrolidinyl)ethyl]-, phenylmethyl ester, identified by its CAS number 886362-96-5, is a chemical compound that belongs to the class of carbamates. This substance features a carbamic acid moiety, which is characterized by the presence of a carbonyl group (C=O) attached to a nitrogen atom (N) that is also bonded to an alkyl or aryl group. The compound includes a methyl group and a phenylmethyl (benzyl) group, contributing to its structural complexity and potential biological activity. The presence of the pyrrolidine ring suggests that it may exhibit properties related to neurotransmitter modulation or other pharmacological effects. Carbamates are often known for their applications in agriculture as pesticides or in medicinal chemistry as potential therapeutic agents. The specific characteristics, such as solubility, stability, and reactivity, would depend on the molecular structure and functional groups present, influencing its behavior in various chemical environments. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C15H22N2O2
InChI:InChI=1/C15H22N2O2/c1-16(11-12-17-9-5-6-10-17)15(18)19-13-14-7-3-2-4-8-14/h2-4,7-8H,5-6,9-13H2,1H3
InChI key:InChIKey=JGABXAAXTUOSNH-UHFFFAOYSA-N
SMILES:C(OC(N(CCN1CCCC1)C)=O)C2=CC=CC=C2
Synonyms:
  • Benzyl methyl[2-(pyrrolidin-1-yl)ethyl]carbamate
  • Carbamic acid, methyl[2-(1-pyrrolidinyl)ethyl]-, phenylmethyl ester
Found 2 products.