CymitQuimica logo

CAS 886363-18-4

:

4-(1H-Indol-5-yl)benzoic acid

Description:
4-(1H-Indol-5-yl)benzoic acid, identified by its CAS number 886363-18-4, is an organic compound characterized by the presence of both an indole and a benzoic acid moiety. This compound features a benzoic acid group attached to the 4-position of an indole ring, which contributes to its potential biological activity. It typically appears as a solid at room temperature and is soluble in organic solvents, with limited solubility in water. The presence of the carboxylic acid functional group allows for hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may exhibit properties such as anti-inflammatory, anticancer, or antimicrobial activities, making it of interest in medicinal chemistry and drug development. Its structural characteristics also suggest potential for use in various applications, including as a building block in organic synthesis or as a ligand in coordination chemistry. As with many indole derivatives, the compound's behavior in biological systems can be complex, warranting further investigation into its pharmacological properties.
Formula:C15H11NO2
InChI:InChI=1S/C15H11NO2/c17-15(18)11-3-1-10(2-4-11)12-5-6-14-13(9-12)7-8-16-14/h1-9,16H,(H,17,18)
InChI key:InChIKey=SWOGZDRHFZTAMW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(C=2C=C3C(=CC2)NC=C3)C=C1
Synonyms:
  • 4-(5'-Indole)benzoic acid
  • Benzoic acid, 4-(1H-indol-5-yl)-
  • 4-(1H-Indol-5-yl)benzoic acid
Found 4 products.