CymitQuimica logo

CAS 886363-20-8

:

2-[3-(1H-indol-5-yl)phenyl]acetic acid

Description:
2-[3-(1H-indol-5-yl)phenyl]acetic acid, with the CAS number 886363-20-8, is an organic compound characterized by its unique structure that combines an indole moiety with a phenyl group, linked to an acetic acid functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the indole ring suggests possible interactions with biological systems, particularly in relation to neurotransmitter pathways, as indoles are known to influence serotonin receptors. The acetic acid component may contribute to its acidity and potential for forming salts or esters. Overall, this compound's structural features suggest it could have applications in medicinal chemistry, particularly in the development of novel therapeutic agents targeting various biological pathways. Further studies would be necessary to fully elucidate its pharmacological properties and potential uses.
Formula:C16H13NO2
InChI:InChI=1/C16H13NO2/c18-16(19)9-11-2-1-3-12(8-11)13-4-5-15-14(10-13)6-7-17-15/h1-8,10,17H,9H2,(H,18,19)
InChI key:UTQLDLXUWNVRHF-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)c1ccc2c(cc[nH]2)c1)CC(=O)O
Synonyms:
  • [3-(1H-Indol-5-yl)phenyl]acetic acid
  • Benzeneacetic acid, 3-(1H-indol-5-yl)-
  • 3-(5'-Indole)phenyl acetic acid
Found 4 products.