CymitQuimica logo

CAS 886363-23-1

:

2-[2-(3,5-difluorophenyl)phenyl]acetic acid

Description:
2-[2-(3,5-difluorophenyl)phenyl]acetic acid, identified by its CAS number 886363-23-1, is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with a 3,5-difluorophenyl group and an acetic acid functional group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as potential acidity due to the carboxylic acid group, which can donate protons in solution. The presence of fluorine atoms in the structure can influence its electronic properties, potentially enhancing lipophilicity and altering its reactivity. As a result, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, 2-[2-(3,5-difluorophenyl)phenyl]acetic acid represents a complex molecule with potential applications in pharmaceuticals and materials science, warranting further investigation into its properties and uses.
Formula:C14H10F2O2
InChI:InChI=1/C14H10F2O2/c15-11-5-10(6-12(16)8-11)13-4-2-1-3-9(13)7-14(17)18/h1-6,8H,7H2,(H,17,18)
InChI key:UIXYPLIOPWTRSX-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)CC(=O)O)c1cc(cc(c1)F)F
Synonyms:
  • (3',5'-Difluorobiphenyl-2-yl)acetic acid
  • [1,1'-Biphenyl]-2-acetic acid, 3',5'-difluoro-
Found 3 products.